Introduction:Basic information about CAS 108043-21-6|1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro-, mixt. with alpha-(2-fluorophenyl)-a, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro-, mixt. with alpha-(2-fluorophenyl)-alpha-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol |
|---|
| CAS Number | 108043-21-6 | Molecular Weight | 567.2 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H13Cl4F2N5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,3-Benzenedicarbonitrile, 2,4,5,6-tetrachloro-, mixt. with alpha-(2-fluorophenyl)-alpha-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H13Cl4F2N5O |
|---|
| Molecular Weight | 567.2 |
|---|
| InChIKey | NCPYLZYFHADCGI-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl.OC(Cn1cncn1)(c1ccc(F)cc1)c1ccccc1F |
|---|