Introduction:Basic information about CAS 57017-75-1|(3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazi, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazinedione |
|---|
| CAS Number | 57017-75-1 | Molecular Weight | 325.75 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H16ClN3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazinedione |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H16ClN3O4 |
|---|
| Molecular Weight | 325.75 |
|---|
| InChIKey | COPDJXMFPVQUPI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1.O=c1ccc(=O)[nH][nH]1 |
|---|