Introduction:Basic information about CAS 52233-24-6|Cyclopropanecarboxamide, N-[5-(2-chloro-1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-, m, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclopropanecarboxamide, N-[5-(2-chloro-1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-, mixt. with 2,2-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)propanamide |
|---|
| CAS Number | 52233-24-6 | Molecular Weight | 493.1 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C25H37ClN4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Cyclopropanecarboxamide, N-[5-(2-chloro-1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-, mixt. with 2,2-dimethyl-N-(1-methylethyl)-N-(phenylmethyl)propanamide |
|---|
Chemical & Physical Properties
| Molecular Formula | C25H37ClN4O2S |
|---|
| Molecular Weight | 493.1 |
|---|
| InChIKey | VJWZDWTZJZBKSX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(CCl)c1nnc(NC(=O)C2CC2)s1.CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C |
|---|