Introduction:Basic information about CAS 57571-05-8|Propanoic acid, 2-(2,4-dichlorophenoxy)-, 2-butoxyethyl ester mixt. with 2-butoxyethy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanoic acid, 2-(2,4-dichlorophenoxy)-, 2-butoxyethyl ester mixt. with 2-butoxyethyl (2,4-dichlorophenoxy)acetate |
|---|
| CAS Number | 57571-05-8 | Molecular Weight | 656.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C29H38Cl4O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Propanoic acid, 2-(2,4-dichlorophenoxy)-, 2-butoxyethyl ester mixt. with 2-butoxyethyl (2,4-dichlorophenoxy)acetate |
|---|
Chemical & Physical Properties
| Molecular Formula | C29H38Cl4O8 |
|---|
| Molecular Weight | 656.4 |
|---|
| InChIKey | RREAEKBGHAJZBS-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOCCOC(=O)C(C)Oc1ccc(Cl)cc1Cl.CCCCOCCOC(=O)COc1ccc(Cl)cc1Cl |
|---|