Introduction:Basic information about CAS 82824-95-1|Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] est, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester mixt. with 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
|---|
| CAS Number | 82824-95-1 | Molecular Weight | 742.7 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C29H42Cl2N3O7PS3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Phosphorodithioic acid, O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester mixt. with 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
|---|
Chemical & Physical Properties
| Molecular Formula | C29H42Cl2N3O7PS3 |
|---|
| Molecular Weight | 742.7 |
|---|
| InChIKey | IBZNVNMPQFZFIT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1.CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl |
|---|