Introduction:Basic information about CAS 943012-36-0|Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dim, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel-, mixt. with cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
|---|
| CAS Number | 943012-36-0 | Molecular Weight | 839.2 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C45H41Cl3F3NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethyl-, (2-methyl[1,1'-biphenyl]-3-yl)methyl ester, (1R,3R)-rel-, mixt. with cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
|---|
Chemical & Physical Properties
| Molecular Formula | C45H41Cl3F3NO5 |
|---|
| Molecular Weight | 839.2 |
|---|
| InChIKey | QNWJLBDLBGENHC-ZOSWZYQDSA-N |
|---|
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1.Cc1c(COC(=O)C2C(C=C(Cl)C(F)(F)F)C2(C)C)cccc1-c1ccccc1 |
|---|