Introduction：Basic information about CAS 294193-86-5|4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine |
|---|
| CAS Number | 294193-86-5 | Molecular Weight | 347.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H17N5S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H17N5S |
|---|
| Molecular Weight | 347.4 |
|---|
| InChIKey | AKDKHZVFMAWBFX-AUEPDCJTSA-N |
|---|
| SMILES | C(=NNc1ncnc2sc3c(c12)CCCC3)c1c[nH]c2ccccc12 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
