Introduction:Basic information about CAS 322637-52-5|1H-Imidazole-1-acetamide, 2-nitro-N-(2,2,3,3,3-pentafluoropropyl)-, labeled with flu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Imidazole-1-acetamide, 2-nitro-N-(2,2,3,3,3-pentafluoropropyl)-, labeled with fluorine-18 |
|---|
| CAS Number | 322637-52-5 | Molecular Weight | 297.17 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H7F5N4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-Imidazole-1-acetamide, 2-nitro-N-(2,2,3,3,3-pentafluoropropyl)-, labeled with fluorine-18 |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H7F5N4O3 |
|---|
| Molecular Weight | 297.17 |
|---|
| InChIKey | JGGDSDPOPRWSCX-YUEAXVSCSA-N |
|---|
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])NCC(F)(F)C(F)(F)F |
|---|