Introduction：Basic information about CAS 220289-47-4|Menthol and methyl salicylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Menthol and methyl salicylate |
|---|
| CAS Number | 220289-47-4 | Molecular Weight | 308.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H28O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Menthol and methyl salicylate |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H28O4 |
|---|
| Molecular Weight | 308.4 |
|---|
| InChIKey | KNXBGPFSZNTOLE-YMQJAAJZSA-N |
|---|
| SMILES | CC1CCC(C(C)C)C(O)C1.COC(=O)c1ccccc1O |
|---|
