Introduction：Basic information about CAS 620633-77-4|AB-13 (impurity of OK-5101), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AB-13 (impurity of OK-5101) |
|---|
| CAS Number | 620633-77-4 | Molecular Weight | 722.8 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C40H45F3N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | AB-13 (impurity of OK-5101) |
|---|
Chemical & Physical Properties
| Molecular Formula | C40H45F3N2O7 |
|---|
| Molecular Weight | 722.8 |
|---|
| InChIKey | XQXUZYJNFBXNMJ-UHFFFAOYSA-N |
|---|
| SMILES | COCCOC(=O)C(=C1N=C(c2ccccc2C(F)(F)F)OC(=C(C(=O)OCCOC)c2ccc(C(C)(C)C)cc2)N1)c1ccc(C(C)(C)C)cc1 |
|---|
