Introduction:Basic information about (-)-DIACETYL-L-TARTARIC ACID CAS 51591-38-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(-)-DIACETYL-L-TARTARIC ACID Basic information
| Product Name: | (-)-DIACETYL-L-TARTARIC ACID |
| Synonyms: | (R,R)-DIACETYLTARTARIC ACID;Diacetyltartaricacid;[R(R*,R*)]-2,3-bis(acetoxy)succinic acid;(-)-DIACETYL-L-TARTARIC ACID 98+%;(-)-2-O,3-O-Diacetyl-L-tartaric acid;(-)-Di-O-acetyl-L-tartaric acid;(+)-L-Tartaric acid 2,3-diacetate;(2R,3R)-2,3-Bis(acetyloxy)butanedioic acid |
| CAS: | 51591-38-9 |
| MF: | C8H10O8 |
| MW: | 234.16 |
| EINECS: | 257-303-8 |
| Product Categories: | Synthetic Organic Chemistry;Carboxylic Acids (Chiral);Chiral Building Blocks;for Resolution of Bases;Optical Resolution |
| Mol File: | 51591-38-9.mol |
|
(-)-DIACETYL-L-TARTARIC ACID Chemical Properties
| Melting point | 120°C |
| alpha | -24.0 to -26.0 deg(C=10, Aceton) |
| Boiling point | 398.9±42.0 °C(Predicted) |
| density | 1.486±0.06 g/cm3(Predicted) |
| refractive index | -25 ° (C=10, Acetone) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency in Acetone |
| form | powder to crystal |
| pka | 2.12±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H10O8/c1-3(9)15-5(7(11)12)6(8(13)14)16-4(2)10/h5-6H,1-2H3,(H,11,12)(H,13,14)/t5-,6-/m1/s1 |
| InChIKey | DNISEZBAYYIQFB-PHDIDXHHSA-N |
| SMILES | C(O)(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(O)=O |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2918.13.5000 |
(-)-DIACETYL-L-TARTARIC ACID Usage And Synthesis
| Uses | (-)-Diacetyl-L-tartaric Acid is a derivative of L-Tartaric Acid (T007630), which is a naturally occurring chemical compound found in berries, grapes and various wines, and provides antioxidant properties and contributes to the sour taste within these products. (-)-Diacetyl-L-tartaric Acid has been studied in relation to wheat, dough additives and properties as an emulsifier. |
(-)-DIACETYL-L-TARTARIC ACID Preparation Products And Raw materials