Introduction:Basic information about (-)-Maackiain CAS 2035-15-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(-)-Maackiain Basic information
| Product Name: | (-)-Maackiain |
| Synonyms: | (6aR,12aR)-6a,12a-Dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-ol;[6aR,12aR,(-)]-6a,12a-Dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-ol;1-Maackiain;(-)-MAACKIAIN;Demethylpterocarpin;MAACKIAIN, (-)-(P);Inermine;Maackiaine |
| CAS: | 2035-15-6 |
| MF: | C16H12O5 |
| MW: | 284.26 |
| EINECS: | 200-258-5 |
| Product Categories: | |
| Mol File: | 2035-15-6.mol |
|
(-)-Maackiain Chemical Properties
| Melting point | 179~181℃ |
| Boiling point | 436.2±45.0 °C(Predicted) |
| density | 1.480±0.06 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in ethanol and methanol; |
| pka | 9.45±0.20(Predicted) |
| form | powder |
| color | White |
| Water Solubility | sparingly soluble in water |
| Major Application | food and beverages |
| InChI | 1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m0/s1 |
| InChIKey | HUKSJTUUSUGIDC-ZBEGNZNMSA-N |
| SMILES | O1[C@@H]2[C@@H](COc5c2ccc(c5)O)c3c1cc4c(c3)OCO4 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
(-)-Maackiain Usage And Synthesis
| Uses | (-)-Maackiain (CAS# 2035-15-6) has potential use in mechanisms of Pyrrosiae Folium in treating prostate cancer based on network pharmacology and molecular docking. |
| Definition | ChEBI: (-)-maackiain is the (-)-enantiomer of maackiain. It is an enantiomer of a (+)-maackiain. |
(-)-Maackiain Preparation Products And Raw materials
| Raw materials | 2H-1-Benzopyran, 7-(phenylmethoxy)--->maackiain acetate-->(+)-MAACKIAIN-->D-(+)-GALACTOSE-->Sesamol |