Introduction：Basic information about (+/-)-exo-6-Hydroxytropinone CAS 5932-53-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(+/-)-exo-6-Hydroxytropinone Basic information
| Product Name: | (+/-)-exo-6-Hydroxytropinone |
| Synonyms: | 6-Hydroxy-8-methyl-8-azabiscyclo[3.2.1]octan-3-one;8-Azabicyclo[3.2.1]octan-3-one, 6-hydroxy-8-methyl-;(1R,5R,7S)-7α-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-3-one;(1β,5β)-6β-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one;6-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one;EXO-6-HYDROXYTROPINONE;HYDROXYTROPINONE,6-;6-HYDROXYTROPINONE |
| CAS: | 5932-53-6 |
| MF: | C8H13NO2 |
| MW: | 155.19 |
| EINECS: | 227-677-7 |
| Product Categories: | Building Blocks;C7 to C8;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;C7 to C8;Carbonyl Compounds;Ketones;Heterocycles |
| Mol File: | 5932-53-6.mol |
|
(+/-)-exo-6-Hydroxytropinone Chemical Properties
| Melting point | 120-121 °C(lit.) |
| Boiling point | 279°C (rough estimate) |
| density | 1.1174 (rough estimate) |
| refractive index | 1.4890 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly, Sonicated), Methanol (Slightly） |
| form | Solid |
| pka | 14.36±0.20(Predicted) |
| color | Light Orange to Brown |
| InChI | InChI=1/C8H13NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5,7-8,11H,2-4H2,1H3/t5-,7+,8-/s3 |
| InChIKey | UOHSTKWPZWFYTF-PIIPYSPBNA-N |
| SMILES | [C@@]12([H])N(C)[C@@]([H])([C@@H](O)C1)CC(=O)C2 |&1:0,4,6,r| |
| LogP | -1.000 (est) |
| CAS DataBase Reference | 5932-53-6(CAS DataBase Reference) |
Safety Information
| Risk Statements | 23/25 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29399990 |
(+/-)-exo-6-Hydroxytropinone Usage And Synthesis
| Chemical Properties | off-white to beige crystals or crystalline powder |
| Uses | (+/-)-Exo-6-hydroxytropinone is a useful reagent for the preparation of racemic scopolamine (tropane alkaloid). |
(+/-)-exo-6-Hydroxytropinone Preparation Products And Raw materials
| Raw materials | 1,3-Acetonedicarboxylic acid-->HYDROXY-1,4-BUTANEDIAL |
| Preparation Products | 6-ACETHYOXY-8-METHYL-8-AZABICYCLO(3.2.1)OCTAN-3-ONE-->3,6-Dihydroxy-8-methyl-8-azabicyclo[3.2.1]octane-6-acetate |
