Introduction:Basic information about (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole CAS 885051-07-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Basic information
| Product Name: | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole |
| Synonyms: | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole;(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole(+)-BTM;IMidazo[2,1-b]benzothiazole,2,3-dihydro-2-phenyl-, (2R)-;(R)-Benzotetramisole;(2R)-2-Phenyl-2,3-dihydroimidazo[2,1-b][1,3]benzothiazole98+%;(R)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole;(+)-Benzotetramisole;(+)-BTM |
| CAS: | 885051-07-0 |
| MF: | C15H12N2S |
| MW: | 252.33 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 885051-07-0.mol |
|
(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Chemical Properties
| Melting point | 95.0-95.5℃ (ethyl ether hexane ) |
| Boiling point | 428.1±48.0 °C(Predicted) |
| density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 7.53±0.40(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C15H12N2S/c1-2-6-11(7-3-1)12-10-17-13-8-4-5-9-14(13)18-15(17)16-12/h1-9,12H,10H2/t12-/m0/s1 |
| InChIKey | YGCWPCVAVSIFLO-LBPRGKRZSA-N |
| SMILES | S1C2=CC=CC=C2N2C[C@@H](C3=CC=CC=C3)N=C12 |
Safety Information
(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Usage And Synthesis
| Uses | (2R)-2,3-dihydro-2-phenylimidazo[2,1-B]benzothiazole is a heterocyclic organic compound that can be used as an isothiourea catalyst. |
(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Preparation Products And Raw materials