Introduction：Basic information about (2-methylpropanoyl)thiourea CAS 6965-58-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(2-methylpropanoyl)thiourea Basic information
| Product Name: | (2-methylpropanoyl)thiourea |
| Synonyms: | (2-METHYLPROPANOYL)THIOUREA;Propanamide, N-(aminothioxomethyl)-2-methyl-;N-carbamothioylisobutyramide;2-Methylpropionyl thiourea;2-Isopropylcarbonylthiourea;N-carbamothioyl-2-methylpropanamide |
| CAS: | 6965-58-8 |
| MF: | C5H10N2OS |
| MW: | 146.21 |
| EINECS: | 807-595-3 |
| Product Categories: | |
| Mol File: | 6965-58-8.mol |
|
(2-methylpropanoyl)thiourea Chemical Properties
| Melting point | 111-112 °C |
| density | 1.159±0.06 g/cm3(Predicted) |
| form | Powder |
| pka | 10.99±0.70(Predicted) |
| InChI | InChI=1S/C5H10N2OS/c1-3(2)4(8)7-5(6)9/h3H,1-2H3,(H3,6,7,8,9) |
| InChIKey | QDAGIMDDJUTAFV-UHFFFAOYSA-N |
| SMILES | C(NC(N)=S)(=O)C(C)C |
Safety Information
(2-methylpropanoyl)thiourea Usage And Synthesis
(2-methylpropanoyl)thiourea Preparation Products And Raw materials
| Raw materials | Isobutyryl chloride-->Carbamimidothioic acid |
