Introduction：Basic information about (7Z,11Z,13E)-hexadeca-7,11,13-trienal CAS 888042-38-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. (7Z,11Z,13E)-hexadeca-7,11,13-trienal Basic information
- 2. (7Z,11Z,13E)-hexadeca-7,11,13-trienal Chemical Properties
- 3. Safety Information
- 4. (7Z,11Z,13E)-hexadeca-7,11,13-trienal Usage And Synthesis
- 5. (7Z,11Z,13E)-hexadeca-7,11,13-trienal Preparation Products And Raw materials
(7Z,11Z,13E)-hexadeca-7,11,13-trienal Basic information
| Product Name: | (7Z,11Z,13E)-hexadeca-7,11,13-trienal |
| Synonyms: | (7Z,11Z,13E)-hexadeca-7,11,13-trienal;7,11,13-Hexadecatrienal, (7Z,11Z,13E)-;7Z,11Z,13E-Hexadecatrienal;7Z,11Z,13E-Hexadecatriena |
| CAS: | 888042-38-4 |
| MF: | C16H26O |
| MW: | 234.38 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 888042-38-4.mol |
|
(7Z,11Z,13E)-hexadeca-7,11,13-trienal Chemical Properties
| InChI | InChI=1S/C16H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h3-6,9-10,16H,2,7-8,11-15H2,1H3/b4-3+,6-5-,10-9- |
| InChIKey | SXCDAEFYAJTNJF-YURISSCBSA-N |
| SMILES | C(=O)CCCCC/C=C\CC/C=C\C=C\CC |
| EPA Substance Registry System | 7,11,13-Hexadecatrienal, (7Z,11Z,13E)- (888042-38-4) |
Safety Information
(7Z,11Z,13E)-hexadeca-7,11,13-trienal Usage And Synthesis
| Definition | ChEBI: 7Z,11Z,13E-Hexadecatrienal is a fatty aldehyde. |
(7Z,11Z,13E)-hexadeca-7,11,13-trienal Preparation Products And Raw materials
(8S,9R,10S,13S,14S,17R)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phe
