(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate CAS 105379-24-6
Introduction：Basic information about (Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate CAS 105379-24-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate Basic information
| Product Name: | (Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate |
| Synonyms: | O-BENZOTRIAZOL-1-YL-N N N' N'-BIS(TETRA&;O-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene;HBPyUO-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene)uroniumhexafluorophosphate;1-[(1H-BENZOTRIAZOL-1-YLOXY)(PYRROLIDIN-1-YL)METHYLIDENE]PYRROLIDINIUM HEXAFLUOROPHOSPHATE;benzotriazolyl-bis(tetramethylene)uronium fluorophosphate;HBPyU, (Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate;HBPYU;(BENZOTRIAZOL-1-YLOXY)DIPYRROLIDINOCARBENIUM HEXAFLUOROPHOSPHATE |
| CAS: | 105379-24-6 |
| MF: | C15H20F6N5OP |
| MW: | 431.32 |
| EINECS: | |
| Product Categories: | Coupling Reagent |
| Mol File: | 105379-24-6.mol |
(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate Chemical Properties
| Melting point | 176 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear |
| form | Powder |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C15H20N5O.F6P/c21-20-14-8-2-1-7-13(14)19(16-20)15(17-9-3-4-10-17)18-11-5-6-12-18;1-7(2,3,4,5)6/h1-2,7-8H,3-6,9-12H2;/q+1;-1 |
| InChIKey | XKTRAGMCMJYRRN-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(/N1CCCC1)(\N1CCCC1)=[N+]1\N=N(=O)C2C=CC=CC\1=2 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | White crystalline powder |
| Uses | Catalyst for synthesis of dyes Reagent for peptide coupling |
| reaction suitability | reaction type: Coupling Reactions |
(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate Preparation Products And Raw materials
