Introduction：Basic information about (DHQ)2PHAL CAS 140924-50-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(DHQ)2PHAL Basic information
| Product Name: | (DHQ)2PHAL |
| Synonyms: | Hydroquinine 1,4-Phthalazinediyl Diether, 95+%;1,4-Bis((1R)-((1S,2S,4S)-5-ethylquinuclidin-2-yl)(6-methoxyquinolin-4-yl)methoxy)phthalazine;(DHQ)2PHAL,99%e.e.;1,4-Bis(9-O-dihydroquininyl)phthalazine;1,4-Bis(dihydroquinine)phthalazine;4-((R)-((2S)-5-ethylquinuclidin-2-yl)(6-methoxyquinolin-4-yl)methoxy)-1-((R)-((2S,4R)-8-ethylquinuclidin-2-yl)(6-methoxyquinolin-4-yl)methoxy)phthalazine;(DHQ)2 PHAL;(DHQ)2 PHAL, 95+% |
| CAS: | 140924-50-1 |
| MF: | C48H54N6O4 |
| MW: | 778.98 |
| EINECS: | |
| Product Categories: | 1 |
| Mol File: | 140924-50-1.mol |
|
(DHQ)2PHAL Chemical Properties
| Melting point | 178 °C (dec.)(lit.) |
| alpha | 336 º (C=1.2 IN MEOH) |
| density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Sligthly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 9.61±0.70(Predicted) |
| color | White to Off-White |
| Optical Rotation | [α]22/D +336°, c = 1.2 in methanol |
| BRN | 5475677 |
| InChIKey | YUCBLVFHJWOYDN-PPIALRKJSA-N |
| SMILES | CC[C@@H]1CN2CCC1CC2[C@H](Oc3nnc(O[C@@H](C4CC5CCN4C[C@@H]5CC)c6ccnc7ccc(OC)cc67)c8ccccc38)c9ccnc%10ccc(OC)cc9%10 |
| CAS DataBase Reference | 140924-50-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
(DHQ)2PHAL Usage And Synthesis
| Uses | (DHQ)2PHAL is a chiral alkaloid catalyst for the asymmetric chlorinative dearomatization reaction of benzofuran derivatives. |
| General Description | DHQ)2PHAL is a modified cinchona alkaloid. |
(DHQ)2PHAL Preparation Products And Raw materials
| Preparation Products | (R,R)-(+)-HYDROBENZOIN |
