Introduction：Basic information about (R)-4-Benzyl-2-oxazolidinone CAS 102029-44-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(R)-4-Benzyl-2-oxazolidinone Basic information
| Product Name: | (R)-4-Benzyl-2-oxazolidinone |
| Synonyms: | 4-benzyl-2-0xazolidinone;(R)-4-BENZYL-2-OXAZOLIDINONE HPLC 99+%;(R)-4-BENZYL-2-OXAZOLIDINONE 98.0%;(4R)-4-(Phenylmethyl)-1,3-oxazolidin-2-one;(4R)-4-(Phenylmethyl)-2-oxazolidinone;(4R)-Benzyloxazolidin-2-one;(4R)-Phenylmethyl-2-oxazolidinone;(R)-(+)-4-BENZYL-2-OXAZOLIDINONE FOR SYN |
| CAS: | 102029-44-7 |
| MF: | C10H11NO2 |
| MW: | 177.2 |
| EINECS: | 600-264-2 |
| Product Categories: | Asymmetric Synthesis;Chiral Auxiliaries;Peptide;Aromatics;Chiral Reagents;Heterocycles;Ketone;Asymmetric Synthesis;Chiral Building Blocks;Glycidyl Compounds, etc. (Chiral);Synthetic Organic Chemistry;Chiral chemicals;chiral;Chiral Compounds;Oxazolidinone;Oxazolidinone Derivatives |
| Mol File: | 102029-44-7.mol |
|
(R)-4-Benzyl-2-oxazolidinone Chemical Properties
| Melting point | 88-90 °C |
| alpha | 62 º (C=1, CHCl3) |
| Boiling point | 309.12°C (rough estimate) |
| density | 1.1607 (rough estimate) |
| refractive index | 14.5 ° (C=5, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly) |
| pka | 12.78±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to almost white |
| Optical Rotation | [α]18/D +64°, c = 1 in chloroform |
| Water Solubility | Insoluble in water. Soluble in Chloroform. |
| Sensitive | Hygroscopic |
| BRN | 4782551 |
| InChI | 1S/C10H11NO2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)/t9-/m1/s1 |
| InChIKey | OJOFMLDBXPDXLQ-SECBINFHSA-N |
| SMILES | O=C1N[C@@H](CO1)Cc2ccccc2 |
| CAS DataBase Reference | 102029-44-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
(R)-4-Benzyl-2-oxazolidinone Usage And Synthesis
| Description | (R)-4-Benzyl-2-oxazolidinone is a derivative of oxazolidinone. It can be used in the preparation of enantiopure carbocyclic nucleosides, which act as a HIV protease inhibitor. It can also be used as a chiral auxiliary in the enantioselective synthesis of (2R, 2′S)-erythro-methylphenidate, beta-lactams and alpha-amino acids. Its end product includes asymmetric single isomeric drugs such as antitumor, anesthetic and entipasmodic products. |
| Chemical Properties | white to light yellow crystal powde |
| Uses | intermediate for Aliskiren hemifumarate, Darifenacin HBr, Zolmitriptan |
| Uses | (R)-(+)-4-Benzyl-2-oxazolidinones are used in the enantioselective synthesis of beta-lactams and alpha-amino acids. End products can include asysmmetric single isomeric drugs of antitumor, anesthetic, antipasmodic products. Used in the synthesis of HIV protease inhibitors. An oxazolidinone used in chiral auxiliary asymetric synthesis. |
| References | http://www.sigmaaldrich.com/catalog/product/aldrich/300977? lang=en®ion=US
https://www.alfa.com/en/catalog/A16770/ Shieh, Wen Chung, et al. "Synthesis of enantiomerically enriched 4- piperidinylglycine." US, US 6670477B2. 2003. |
(R)-4-Benzyl-2-oxazolidinone Preparation Products And Raw materials
