Introduction：Basic information about (S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid CAS 17257-71-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid Basic information
| Product Name: | (S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid |
| Synonyms: | (S)-(-)-ɑ-Methoxy-ɑ-(trifluoromethyl)phenylacetic acid, 99%;(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Acid [Optical Resolving];(-)-MTPA, Moshers acid;(S)-(-)-Mosheracid;(S)-2-Methoxy-2-phenyl-3,3,3-trifluoropropanoic acid;[S,(-)]-3,3,3-Trifluoro-2-methoxy-2-phenylpropionic acid;[S,(-)]-α-Trifluoromethyl-α-methoxyphenylacetic acid;[S,(-)]-β,β,β-Trifluoro-α-methoxyhydratropic acid |
| CAS: | 17257-71-5 |
| MF: | C10H9F3O3 |
| MW: | 234.17 |
| EINECS: | 241-292-1 |
| Product Categories: | Analytical Chemistry;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination |
| Mol File: | 17257-71-5.mol |
|
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid Chemical Properties
| Melting point | 46-49 °C(lit.) |
| Boiling point | 95-97 °C0.05 mm Hg(lit.) |
| alpha | D24 -71.8± 0.6° (c = 3.28 in CH3OH) |
| density | 1.303 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.474(lit.) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Readily soluble in hexane, ether, THF, CH2Cl2, benzene. |
| pka | 1.47±0.10(Predicted) |
| form | Viscous Liquid or Low Melting Solid |
| Specific Gravity | 1.303 |
| color | Clear colorless or white |
| Optical Rotation | [α]20/D 73±1°, c = 2% in methanol |
| Sensitive | Hygroscopic |
| Merck | 14,6280 |
| BRN | 3591561 |
| InChI | 1S/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@](C(O)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 17257-71-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, HYGROSCOPIC, KEEP COLD |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid Usage And Synthesis
| Chemical Properties | clear colorless viscous liquid |
| Uses | (S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid is used as a chiral derivatizing agent, it reacts with an alcohol or amine of unknown stereochemistry to form an ester or amide. The absolute configuration of the ester or amide is then determined by proton and/or 19F NMR spectroscopy. |
| General Description | (S)-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetic acid is commonly used as a derivatizing agent in Mosher ester analysis and Mosher amide analysis, which are NMR-based methods for determining the absolute configuration of the chiral carbon center in secondary alcohols and amines, respectively. |
| Purification Methods | A likely impurity is phenylethylamine from the resolution. Dissolve the acid in Et2O/*benzene (3:1), wash with 0.5N H2SO4, then water, dry over magnesium sulfate, filter, evaporate and distil it. [Dale et al. J Org Chem 34 2543 1969, J Am Chem Soc 75 512 1973.] |
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid Preparation Products And Raw materials
