Introduction:Basic information about (S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) CAS 132098-54-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) Basic information
| Product Name: | (S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) |
| Synonyms: | (S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE);2,2'-Methylenebis[(4S)-4-tert-butyl-4,5-dihydro-2-oxazole];Bis((4S)-4-tert-butyl-4,5-dihydrooxazol-2-yl)methane;bis((S)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)methane;(4S,4'S)-2,2'-methylenebis[4-(1,1-dimethylethyl)-4,5-dihydro-Oxazole;Oxazole, 2,2'-methylenebis[4-(1,1-dimethylethyl)-4,5-dihydro-, (4S,4'S)-;Bis[(S)-4-(tert-butyl)-4,5-dihydro-2-oxazolyl]methane;2,2′-Methylenebis[(4S)-4-tert-butyl-2-oxazoline] |
| CAS: | 132098-54-5 |
| MF: | C15H26N2O2 |
| MW: | 266.38 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 132098-54-5.mol |
|
(S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) Chemical Properties
| Melting point | 51-53 °C(lit.) |
| Boiling point | 328.8±25.0 °C(Predicted) |
| density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.39±0.70(Predicted) |
| Appearance | White to off-white Solid |
| Optical Rotation | [α]20/D 118°, c = 0.5 in chloroform |
| BRN | 4190673 |
| InChI | InChI=1S/C15H26N2O2/c1-14(2,3)10-8-18-12(16-10)7-13-17-11(9-19-13)15(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | WCCCBUXURHZPQL-GHMZBOCLSA-N |
| SMILES | C(C1=N[C@@H](C(C)(C)C)CO1)C1=N[C@@H](C(C)(C)C)CO1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
(S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) Usage And Synthesis
| Uses | C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals. |
(S,S)-2,2'-METHYLENEBIS(4-TERT-BUTYL-2-OXAZOLINE) Preparation Products And Raw materials
| Preparation Products | (S,S)-(-)-2,2'-ISOPROPYLIDENEBIS(4-TERT-BUTYL-2-OXAZOLINE)-->(4S,4'S)-2,2'-Cyclopropylidenebis[4-tert-butyl-4,5-dihydrooxazole],99%e.e. |