Introduction:Basic information about [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate CAS 1046786, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
[(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Basic information
| Product Name: | [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate |
| Synonyms: | Shibata Reagent I;2-[dimethyliminio(trifluoromethyl)-$l^{4}-sulfanyl]phenolate tetrafluoroborate;[(Oxido)phenyl(trifluoromethyl)-λ4-sulfanylidene]dimethylammonium tetrafluoroborate;N-Methyl-N-[oxidophenyl(trifluoromethyl)-λ4-sulfanylidene]methanaminium (1:1) tetrafluoroborate;N,N-Dimethyl-S-phenyl-S-(trifluoromethyl)sulfoximinium tetrafluoroborate;N-Methyl-N-[oxidophenyl(trifluoromethyl)-4-sulfanylidene]methanaminium (1:1) tetrafluoroborate tetrafluoroborate;[(Oxido)phenyl(trifluoromethyl)-λ4-sulfanylidene]dimethylammonium Tetrafluoroborate |
| CAS: | 1046786-08-6 |
| MF: | C9H11F3NOS.BF4 |
| MW: | 342.0850824 |
| EINECS: | |
| Product Categories: | Chemical Synthesis;Fluorination;Fluorination Reagents;New Products for Chemical Synthesis;Synthetic Reagents |
| Mol File: | 1046786-08-6.mol |
|
[(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Chemical Properties
| Melting point | 85-90℃ |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C9H11F3NOS.BF4/c1-13(2)15(14,9(10,11)12)8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,1-2H3;/q+1;-1 |
| InChIKey | JQIUQSKIGNTITL-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.C[N+](C)=S(=O)(c1ccccc1)C(F)(F)F |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 1759 8/PG III |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
[(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Usage And Synthesis
| Uses | Reagent for the preparation of monofluoromethyl esters and ethers |
[(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate Preparation Products And Raw materials