[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride CAS 15629-92-2
Introduction：Basic information about [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride CAS 15629-92-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Basic informationReaction
| Product Name: | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride |
| Synonyms: | NiCl2(DPPP)NiCl2(DPPP);1.3-Bis(dipheny phosphine) propane nickel(II)chloride;DICHLORO[1,3-BIS-(DIPHENYLPHOSPHINO)PROPANE] NICKE;NICL2(DPPP)/ 1,3-BIS(DIPHENY PHOSPHINE) PROPANE NICKEL(II)CHLORIDE;1,3-Bis(diphenyl phosphine)propane nickel(II)dichloride;1,3-Bis-(diphenylphosphino)-propane nickel chloride;Dichlorobis(1,3-diphenylphosphino)propaneünickel(II), C 59.9%;(1,3-dppp)NiCl2, 1,3-Bis(diphenylphosphino)propane nickel(II) chloride |
| CAS: | 15629-92-2 |
| MF: | C27H26Cl2NiP2 |
| MW: | 542.04 |
| EINECS: | 605-052-3 |
| Product Categories: | metal-phosphine complexes;Ni;Metal Compounds;Boron, Nitrile, Thio,& TM-Cpds;Catalysts for Organic Synthesis;Classes of Metal Compounds;Homogeneous Catalysts;Metal Complexes;Ni (Nickel) Compounds;Synthetic Organic Chemistry;Transition Metal Compounds |
| Mol File: | 15629-92-2.mol |
[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Chemical Properties
| Melting point | 213 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | red |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| InChI | InChI=1S/C27H26P2.2ClH.Ni/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;;;/h1-12,14-21H,13,22-23H2;2*1H;/q;;;+2/p-2 |
| InChIKey | ZBQUMMFUJLOTQC-UHFFFAOYSA-L |
| SMILES | P(C1=CC=CC=C1)(CCCP(C1C=CC=CC=1)C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl |
| CAS DataBase Reference | 15629-92-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xn |
| Risk Statements | 49-36/37/38-42/43-40 |
| Safety Statements | 53-26-36/37/39-45-24-22 |
| RIDADR | 3282 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1A Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Reaction |
|
| Chemical Properties | red to red-brown powder or crystals |
| Uses | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride is used as an effective catalyst for Kumada coupling and Suzuki reactions. It also catalyzes other reactions to convert enol ethers, dithioacetals and vinyl sulfides to olefins. Further, it is used as a catalyst for preparation of block-copolythiophenes and solid state metathesis polycondensation. |
| Application | Catalyst for: Synthesis of block-copolythiophenes Suzuki-Miyaura cross-coupling reaction of aryl halides with arylboronic acids Solid state metathesis polycondensation Polymerization of poly(3-alkoxythiophene)s Diastereoselective Nozaki-Hiyama-Kishi coupling reactions of C1-C19 fragment of macrolide antibiotic aplyronine A Transfer condensation polymerization of conjugated polymers [1,3-Bis(diphenylphosphino)propane]dichloronickel(II) can be used as a precursor to synthesize metal-fullerene coordination complexes by reduction method. |
| reaction suitability | core: nickel reaction type: Cross Couplings reagent type: catalyst |
[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Preparation Products And Raw materials
| Raw materials | Ethanol-->Sodium hydroxide-->Hydrochloric acid-->Ethyl acetate-->Tetrahydrofuran-->Dichloromethane-->PETROLEUM ETHER-->Triphenylphosphine-->Lithium-->Nickel(II) chloride hexahydrate-->Diphenylphosphine-->1,3-Bis(diphenylphosphino)propane-->1,3-Dibromopropane-->1,3-Dichloropropane |
