Introduction：Basic information about [1S,2S,(-)]-1,2-Cyclohexanedimethanol CAS 3205-34-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. [1S,2S,(-)]-1,2-Cyclohexanedimethanol Basic information
- 2. [1S,2S,(-)]-1,2-Cyclohexanedimethanol Chemical Properties
- 3. Safety Information
- 4. [1S,2S,(-)]-1,2-Cyclohexanedimethanol Usage And Synthesis
- 5. [1S,2S,(-)]-1,2-Cyclohexanedimethanol Preparation Products And Raw materials
[1S,2S,(-)]-1,2-Cyclohexanedimethanol Basic information
| Product Name: | [1S,2S,(-)]-1,2-Cyclohexanedimethanol |
| Synonyms: | [(1S,2S)-2-(hydroxymethyl)cyclohexyl]methanol;(S,S)-1,2-Bis(hydroxymethyl)cyclohexane;[1S,2S,(-)]-1,2-Cyclohexanedimethanol;(1S,2S)-Cyclohexane-1,2-dimethanol;(1S,2S)-1,2-Cyclohexanedimethano;(1S,2S)-Cyclohexane-1,2-diyldiMethanol;1,2-Cyclohexanedimethanol, (1S,2S)-;(+)-trans-1,2-Cyclohexanedimethanol |
| CAS: | 3205-34-3 |
| MF: | C8H16O2 |
| MW: | 144.21 |
| EINECS: | 1308068-626-2 |
| Product Categories: | |
| Mol File: | 3205-34-3.mol |
|
[1S,2S,(-)]-1,2-Cyclohexanedimethanol Chemical Properties
| Melting point | 60-63℃ |
| Boiling point | 270℃ |
| density | 1.004 |
| Fp | 129℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.75±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H16O2/c9-5-7-3-1-2-4-8(7)6-10/h7-10H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | XDODWINGEHBYRT-HTQZYQBOSA-N |
| SMILES | [C@H]1(CO)CCCC[C@@H]1CO |
Safety Information
[1S,2S,(-)]-1,2-Cyclohexanedimethanol Usage And Synthesis
| Uses | (1S,?2S)?-1,?2-?Cyclohexanedimethano?l is an intermediate used to synthesize C2-?symmetrical diphosphines using chiral zinc organometallics. |
[1S,2S,(-)]-1,2-Cyclohexanedimethanol Preparation Products And Raw materials
