Introduction:Basic information about 1-(4-NITROPHENYL)GLYCEROL CAS 2207-68-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-(4-NITROPHENYL)GLYCEROL Basic information
| Product Name: | 1-(4-NITROPHENYL)GLYCEROL |
| Synonyms: | 1-(P-NITROPHENYL)GLYCEROL;4-NITROPHENYL GLYCEROL;ALPHA-P-NITROPHENYLGLYCEROL;P-NITROPHENYL-GLYCEROL;PNP GLYCEROL;PNPG;1-(4-NITROPHENYL)-1,2,3-PROPANETRIOL;1-(4-NITROPHENYL)PROPANE-1,2,3-TRIOL |
| CAS: | 2207-68-3 |
| MF: | C9H11NO5 |
| MW: | 213.19 |
| EINECS: | 218-624-9 |
| Product Categories: | antibiotic;Oxygen Compounds;Anilines, Aromatic Amines and Nitro Compounds;Alcohols;Building Blocks;C9 to C10;Chemical Synthesis;Organic Building Blocks |
| Mol File: | 2207-68-3.mol |
|
1-(4-NITROPHENYL)GLYCEROL Chemical Properties
| Melting point | 98-101 °C(lit.) |
| Boiling point | 353.17°C (rough estimate) |
| density | 1.3707 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | 2-8°C |
| pka | 12.76±0.20(Predicted) |
| form | crystalline |
| color | off-white |
| PH | 4-7 (10g/l, H2O, 20℃) |
| Sensitive | Hygroscopic |
| BRN | 7376091 |
| InChI | 1S/C9H11NO5/c11-5-8(12)9(13)6-1-3-7(4-2-6)10(14)15/h1-4,8-9,11-13H,5H2 |
| InChIKey | IUZVZBIQZKBWCC-UHFFFAOYSA-N |
| SMILES | OCC(O)C(O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 2207-68-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
1-(4-NITROPHENYL)GLYCEROL Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | 1-(4(Nitrophenyl)glycerol is a useful additive for controlling swarming of Proteus bacteria on culture media. |
| Uses | 1-(4-Nitrophenyl)glycerol inhibits the coordinately regulated activities of swarming behavior and virulence factor expression in Proteus mirabilis. |
1-(4-NITROPHENYL)GLYCEROL Preparation Products And Raw materials