Introduction：Basic information about 1,1-Diphenylacetone CAS 781-35-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,1-Diphenylacetone Basic information
| Product Name: | 1,1-Diphenylacetone |
| Synonyms: | BENZHYDRYL METHYL KETONE;2-OXO-1,1-DIPHENYLPROPANE;1,1-DIPHENYLACETONE;1,1-DIPHENYLPROPAN-2-ONE;1,1-DIPHENYL-2-PROPANONE;UNSYM-DIPHENYLACETONE;1,1-diphenyl-2-propanon;methyldiphenylmethylketone |
| CAS: | 781-35-1 |
| MF: | C15H14O |
| MW: | 210.27 |
| EINECS: | 212-307-9 |
| Product Categories: | Aromatic Ketones (substituted) |
| Mol File: | 781-35-1.mol |
|
1,1-Diphenylacetone Chemical Properties
| Melting point | 59-63 °C (lit.) |
| Boiling point | 135 °C (1.5 mmHg) |
| density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1910206 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI | InChI=1S/C15H14O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3 |
| InChIKey | DBNWBEGCONIRGQ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)C(=O)C |
| CAS DataBase Reference | 781-35-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanone, 1,1-diphenyl- (781-35-1) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | UC2010020 |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
1,1-Diphenylacetone Usage And Synthesis
| Chemical Properties | white to light yellow powder |
1,1-Diphenylacetone Preparation Products And Raw materials
| Raw materials | Aluminum chloride-->Chlorine-->Phenylacetone-->BROMOACETONE-->1-Chloro-2-propanol-->1,1,3-Trichloroacetone |
| Preparation Products | DIPHACINONE-->5-BENZHYDRYL-1H-PYRAZOLE, 97 |
