1,3,4,6-Tetrakis(methoxymethyl)glycoluril CAS 17464-88-9
Introduction:Basic information about 1,3,4,6-Tetrakis(methoxymethyl)glycoluril CAS 17464-88-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3,4,6-Tetrakis(methoxymethyl)glycoluril Basic information
| Product Name: | 1,3,4,6-Tetrakis(methoxymethyl)glycoluril |
| Synonyms: | 1,3,4,6-TETRAKIS(METHOXYMETHYL)GLYCOLURIL;1,3,4,6- four(MethoxyMethyl)glycoluril;1,3,4,6-tetrakis(methoxymethyl)glycoluril:tetrahydro-1,3,4,6-tetrakis(methoxymethyl)-imidazo(4,5-d)IMIDAZOLE-2,5(1h,3h)-dione;Tetrakis(methyoxymethyl)glycoluril;Tetrahydro-1,3,4,6-tetrakis(methoxymethyl)-imidazo[4,5-D]imidazole-2,5(1H,3H)-dione;Imidazo4,5-dimidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetrakis(methoxymethyl)-;Tetramethoxymethylglycuril;1,3,4,6-Tetrakis(methoxymethyl)-1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazole-2,5-dione |
| CAS: | 17464-88-9 |
| MF: | C12H22N4O6 |
| MW: | 318.33 |
| EINECS: | 241-480-3 |
| Product Categories: | bc0001 |
| Mol File: | 17464-88-9.mol |
1,3,4,6-Tetrakis(methoxymethyl)glycoluril Chemical Properties
| Melting point | 90-110°C |
| Boiling point | 454.7±45.0 °C(Predicted) |
| density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| pka | -1.09±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H22N4O6/c1-19-5-13-9-10(15(7-21-3)11(13)17)16(8-22-4)12(18)14(9)6-20-2/h9-10H,5-8H2,1-4H3 |
| InChIKey | XGQJGMGAMHFMAO-UHFFFAOYSA-N |
| SMILES | C1(=O)N(COC)C2N(COC)C(=O)N(COC)C2N1COC |
| EPA Substance Registry System | Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetrakis(methoxymethyl)- (17464-88-9) |
Safety Information
| TSCA | TSCA listed |
| HS Code | 2933.99.9701 |
| Uses | Crosslinker for powder coatings, negative hotoresist |
| Uses | 1,3,4,6-Tetrakis(methoxymethyl)glycoluril is used as a crosslinker for powder coatings, photoresists with antireflective coatings, and hydrogels. |
1,3,4,6-Tetrakis(methoxymethyl)glycoluril Preparation Products And Raw materials
| Preparation Products | CUCURBITURIL |
