Introduction：Basic information about 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one CAS 33390-42-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Basic information
- 2. 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Chemical Properties
- 3. Safety Information
- 4. 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Usage And Synthesis
- 5. 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Preparation Products And Raw materials
1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Basic information
| Product Name: | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one |
| Synonyms: | 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9h-xanthen-9-one;gartanin;1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)xanthone;9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-;Aids098106;Aids-098106;1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one;Gartanin, 98%, from Garcinia mangostana L. |
| CAS: | 33390-42-0 |
| MF: | C23H24O6 |
| MW: | 396.43 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 33390-42-0.mol |
|
1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Chemical Properties
| Melting point | 167℃ |
| Boiling point | 644.4±55.0 °C(Predicted) |
| density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Chloroform: soluble |
| form | A solid |
| pka | 7.17±0.20(Predicted) |
| color | Light yellow to yellow |
| InChI | 1S/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| InChIKey | OJXQLGQIDIPMTE-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(O)C(CC=C(C)C)=C(O)C(CC=C(C)C)=C2OC3=C1C(O)=CC=C3O |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Usage And Synthesis
| Uses | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one is an anti-proliferative compound. An isoprenylated xanthone which is an androgen receptor degradation enhancer. A potential neuroprotective agent. |
| Definition | ChEBI: A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 5 and 8 and prenyl groups at positions 2 and 4. |
1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Preparation Products And Raw materials
| Raw materials | 2,3,6-TRIMETHOXYBENZOIC ACID-->Phloroglucinol |
