Introduction：Basic information about 1,3,5-Triisopropylbenzene CAS 717-74-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3,5-Triisopropylbenzene Basic information
| Product Name: | 1,3,5-Triisopropylbenzene |
| Synonyms: | 1,3,5-tris(1-methylethyl)-benzen;2,4,6-Triisopropylbenzene;Benzene, 1,3,5-triisopropyl-;benzene,1,3,5-tris(1-methylethyl)-;1,3,5-TRIISOPROPYLBENZENE;1,3,5-TRIS(1-METHYLETHYL)BENZENE;1,3,5-TriisopropylbenzeneTriisopropylbenzene;1,3,5-Triisopropylbenzol |
| CAS: | 717-74-8 |
| MF: | C15H24 |
| MW: | 204.35 |
| EINECS: | 211-941-3 |
| Product Categories: | Pyrimidines;Aromatic Hydrocarbons (substituted) & Derivatives;Arenes;Building Blocks;Organic Building Blocks;bc0001 |
| Mol File: | 717-74-8.mol |
|
1,3,5-Triisopropylbenzene Chemical Properties
| Melting point | -14--11°C |
| Boiling point | 232-236 °C (lit.) |
| density | 0.845 g/mL at 25 °C (lit.) |
| vapor pressure | 0.91Pa at 25℃ |
| refractive index | n20/D 1.488(lit.) |
| Fp | 188 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.845 |
| Water Solubility | Immiscible with water. |
| BRN | 1862750 |
| InChI | 1S/C15H24/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-12H,1-6H3 |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(cc(c1)C(C)C)C(C)C |
| LogP | 6.68 at 24℃ |
| CAS DataBase Reference | 717-74-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3,5-tris(1-methylethyl)-(717-74-8) |
| EPA Substance Registry System | 1,3,5-Triisopropylbenzene (717-74-8) |
Safety Information
| Safety Statements | 23-24/25 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | CBL |
| HS Code | 29029080 |
| Storage Class | 10 - Combustible liquids |
1,3,5-Triisopropylbenzene Usage And Synthesis
| Description | 1,3,5-Triisopropylbenzene is a versatile compound that has several applications in various industries. It is commonly used as a fuel and fuel additive, as well as in lubricants and lubricant additives. Additionally, it is utilized in the production of 2,4,6-triisopropyl-benzenesulfonyl chloride. This compound is also effective as a swelling agent in the synthesis of mesoporous silica with hexagonal pores. Furthermore, it serves as a micelle expander in the creation of magnetic mesoporous silica nanoparticles. |
| Chemical Properties | Clear colorless liquid |
| Uses | 1,3,5-Triisopropylbenzene can be usually used as swelling agent during the synthesis of mesoporous silicas with two-dimensional hexagonal pores,also used as micelle expander in the synthesis of highly ordered mesoporous SBA-15 silica and magnetic mesoporous silica nanoparticles. |
| Uses | 1,3,5-Triisopropylbenzene is used as a micelle expander in hybrid periodic mesoporous organosilica designed to improve the properties of immobilized enzymes. |
| Flammability and Explosibility | Not classified |
1,3,5-Triisopropylbenzene Preparation Products And Raw materials
| Raw materials | Ethyl acetate-->Diethyl ether-->Dichloromethane-->Magnesium sulfate-->Sodium chloride-->Benzene-->Aluminum chloride-->2-Bromopropane-->1,2,4-TRI-ISO-PROPYLBENZENE-->3-Methyl-1-butynyltrimethylsilane-->2,4,6-TRIBROMOIODOBENZENE-->2,4,6-TRIISOPROPYLBENZENEBORONIC ACID-->2,4,6-TRIISOPROPYLPHENYLBORONIC ACID MET-->3-METHYL-1-BUTYNE-->Dibenzylamine |
| Preparation Products | X-PHOS-->2,4,6-Triisopropylbenzenesulfonyl chloride-->IODOMESITYLENE DIACETATE-->Cumene-->Benzene, 1,3,5-tris(1-methylethyl)-2-nitro- |
