Introduction:Basic information about 1,4-DICHLOROBENZENE-D4 CAS 3855-82-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,4-DICHLOROBENZENE-D4 Basic information
| Product Name: | 1,4-DICHLOROBENZENE-D4 |
| Synonyms: | 1,4-Dichloro-2,3,5,6-tetradeuterobenzene;Benzene, 1,4-dichloro-, [2H4];1,4-DICHLOROBENZENE-D4;P-DICHLOROBENZENE D4;1,4-DICHLOROBENZENE-D4, 1X1ML, CH2CL2, 2 000UG/ML;1,4-DICHLOROBENZENE-D4, 1X1ML, MEOH, 200 0UG/ML;1,4-DICHLOROBENZENE-D4, 98 ATOM % D;1,4-DICHLOROBENZENE-D4, 1000MG, NEAT |
| CAS: | 3855-82-1 |
| MF: | C6Cl2D4 |
| MW: | 151.03 |
| EINECS: | |
| Product Categories: | Alpha Sort;D;DAlphabetic;DIA - DICPesticides;FumigantsPesticides&Metabolites;Insecticides;Labeled;Pesticides;Volatiles/ Semivolatiles |
| Mol File: | 3855-82-1.mol |
|
1,4-DICHLOROBENZENE-D4 Chemical Properties
| Melting point | 52-54°C |
| Melting point | 52-54 °C(lit.) |
| Boiling point | 173 °C(lit.) |
| Boiling point | 173°C |
| density | 1.274 g/mL at 25 °C |
| density | d = 1,34 |
| Fp | 150 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Hexane (Slightly), Methanol (Sparingly) |
| form | Solid |
| color | White to off-white |
| BRN | 2047072 |
| Major Application | environmental |
| InChI | 1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D |
| InChIKey | OCJBOOLMMGQPQU-RHQRLBAQSA-N |
| SMILES | [2H]c1c([2H])c(Cl)c([2H])c([2H])c1Cl |
| CAS DataBase Reference | 3855-82-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Dichlorobenzene-d4 (3855-82-1) |
| CAS Number Unlabeled | 106-46-7 |
Safety Information
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 36-40-50/53-39/23/24/25-23/24/25-11-52/53-67-36/37/38 |
| Safety Statements | 36/37-46-60-61-45-24/25-23-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 |
1,4-DICHLOROBENZENE-D4 Usage And Synthesis
| Uses | 1,4-Dichlorobenzene-d4 is labelled 1,4-Dichlorobenzene (D431875), a versatile building block and a small bioactive molecule, used in various organic synthesis. It is also used as disinfectant, deodorant, and pesticide. |
1,4-DICHLOROBENZENE-D4 Preparation Products And Raw materials
| Preparation Products | 2,5-DICHLOROANILINE-3,4,6-D3 |