Introduction:Basic information about 1,4-DIETHOXY-2-NITROBENZENE CAS 119-23-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,4-DIETHOXY-2-NITROBENZENE Basic information
| Product Name: | 1,4-DIETHOXY-2-NITROBENZENE |
| Synonyms: | 1,4-diethoxy-2-nitro-benzen;NITROHYDROQUINONE DIETHYL ETHER;HYDROQUINONE NITRODIETHYL ETHER;1,4-DIETHOXY-2-NITROBENZENE;2,5-DIETHOXYNITROBENZENE;1-NITRO-2,5-DIETHOXYBENZENE;2-Nitrohydroquinone, diethyl ether;1,4-Diethoxy-2-nitrobenzol |
| CAS: | 119-23-3 |
| MF: | C10H13NO4 |
| MW: | 211.21 |
| EINECS: | 204-308-8 |
| Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives |
| Mol File: | 119-23-3.mol |
|
1,4-DIETHOXY-2-NITROBENZENE Chemical Properties
| Melting point | 48-51 °C(lit.) |
| Boiling point | 169 °C13 mm Hg(lit.) |
| density | 1.2022 (estimate) |
| refractive index | 1.5310 (estimate) |
| Fp | >230 °F |
| form | solid |
| InChI | 1S/C10H13NO4/c1-3-14-8-5-6-10(15-4-2)9(7-8)11(12)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | AUCRWWWSFGZHBK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(OCC)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 119-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,4-diethoxy-2-nitro- (119-23-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
1,4-DIETHOXY-2-NITROBENZENE Usage And Synthesis
| Uses | Reduction of 1,4-diethoxy-2-nitrobenzene, yields 2,5-diethoxyaniline [94-85-9], which is used as an azocoupling component or as the intermediate forFast Blue BB Base by consecutive benzoylation,nitration, and reduction. |
| Production Methods | 1,4-Diethoxybenzene is nitrated in a manner similar to the dimethyl etherto give 1,4-diethoxy-2-nitrobenzene. |
1,4-DIETHOXY-2-NITROBENZENE Preparation Products And Raw materials
| Raw materials | 1,4-Diethoxybenzene |