Introduction：Basic information about 1,4-DIMETHYLPYRAZOLE CAS 1072-68-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,4-DIMETHYLPYRAZOLE Basic information
| Product Name: | 1,4-DIMETHYLPYRAZOLE |
| Synonyms: | 1,4-DIMETHYL-1H-PYRAZOLE;1,4-DIMETHYLPYRAZOLE;Pyrazole, 1,4-dimethyl-;1,4-Dimethyl-1H-pyrazol;1H-Pyrazole, -1,4-dimethyl-;1,4-two methyl pyrazole |
| CAS: | 1072-68-0 |
| MF: | C5H8N2 |
| MW: | 96.13 |
| EINECS: | 600-813-6 |
| Product Categories: | |
| Mol File: | 1072-68-0.mol |
|
1,4-DIMETHYLPYRAZOLE Chemical Properties
| Boiling point | 148-150 °C(Press: 20 Torr) |
| density | 0.9608 g/cm3(Temp: 18 °C) |
| vapor pressure | 3.47-21.3hPa at 20-50℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.80±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5H8N2/c1-5-3-6-7(2)4-5/h3-4H,1-2H3 |
| InChIKey | SZQCPPRPWDXLMM-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(C)C=N1 |
| Surface tension | 68.8mN/m at 1g/L and 20℃ |
Safety Information
1,4-DIMETHYLPYRAZOLE Usage And Synthesis
| Uses | An important intermediate for the herbicide chlorpyrifos, and a pharmaceutical intermediate. |
1,4-DIMETHYLPYRAZOLE Preparation Products And Raw materials
