Introduction：Basic information about 1,4-Diphenoxybenzene CAS 3061-36-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,4-Diphenoxybenzene Basic information
| Product Name: | 1,4-Diphenoxybenzene |
| Synonyms: | 4-Phenoxydiphenyl oxide;Benzene, p-diphenoxy-;p-Phenoxyphenoxybenzene;P-DIPHENOXYBENZENE;TIMTEC-BB SBB007747;HYDROQUINONE DIPHENYL ETHER;DIPHENOXYBENZENE;(4,1-Phenylenebisoxy)bisbenzene |
| CAS: | 3061-36-7 |
| MF: | C18H14O2 |
| MW: | 262.3 |
| EINECS: | 000-000-0 |
| Product Categories: | Miscellaneous;Color Former & Related Compounds;Diphenyl Ethers (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Sensitizer |
| Mol File: | 3061-36-7.mol |
|
1,4-Diphenoxybenzene Chemical Properties
| Melting point | 73-77 °C |
| Boiling point | 172°C 0,01mm |
| density | 1,083 g/cm3 |
| refractive index | 1.5200 (estimate) |
| Fp | 202°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2215945 |
| InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H |
| InChIKey | UVGPELGZPWDPFP-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=CC=C2)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 3061-36-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,4-diphenoxy-(3061-36-7) |
| EPA Substance Registry System | Benzene, 1,4-diphenoxy- (3061-36-7) |
Safety Information
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HS Code | 29029090 |
1,4-Diphenoxybenzene Usage And Synthesis
| Chemical Properties | off-white to light brown flakes or pellets |
| Definition | ChEBI: 1,4-diphenoxybenzene is a?diphenoxybenzene. It is functionally related to a?4-phenoxyphenol. |
1,4-Diphenoxybenzene Preparation Products And Raw materials
| Raw materials | Benzenamine, 2,2'-[1,4-phenylenebis(oxy)]bis--->4-Phenoxyphenol-->4-IODODIPHENYL ETHER-->Phenol-->4-Bromophenoxybenzene-->potassium phenolate-->1,4-Diiodobenzene-->2-Nitrochlorobenzene-->Hydroquinone |
| Preparation Products | 4-Chlorodiphenyl ether-->Ferrocene |
