Introduction:Basic information about 1,4-Diphenoxybutane CAS 3459-88-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,4-Diphenoxybutane Basic information
| Product Name: | 1,4-Diphenoxybutane |
| Synonyms: | 1,4-Diphenoxybutane;4-phenoxybutoxybenzene;Benzene, 1,1'-[1,4-butanediylbis(oxy)]bis- |
| CAS: | 3459-88-9 |
| MF: | C16H18O2 |
| MW: | 242.31 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 3459-88-9.mol |
|
1,4-Diphenoxybutane Chemical Properties
| Melting point | 97-100°C |
| Boiling point | 378.1±25.0 °C(Predicted) |
| density | 1.047±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C16H18O2/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | PMVVWYMWJBCMMI-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=CC=C1)CCCOC1=CC=CC=C1 |
| CAS DataBase Reference | 3459-88-9 |
Safety Information
1,4-Diphenoxybutane Usage And Synthesis
| Chemical Properties | Off-white Crystals |
1,4-Diphenoxybutane Preparation Products And Raw materials