Introduction：Basic information about 1,8-Naphthalic anhydride CAS 81-84-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,8-Naphthalic anhydride Basic information
| Product Name: | 1,8-Naphthalic anhydride |
| Synonyms: | Two1,8-naphthaleneanhydride;Naphthalic anh;1,8 Naphthaloic Anhydride;ai3-09071;Benzo[de]isochromene-1,3-dione;Naphthalenedicarboxylic-1,8-anhydride;naphthalenedicarboxylicanhydride;naphthalic |
| CAS: | 81-84-5 |
| MF: | C12H6O3 |
| MW: | 198.17 |
| EINECS: | 201-380-2 |
| Product Categories: | Naphthalene derivatives;Oxygen cyclic compounds;Intermediates of Dyes and Pigments |
| Mol File: | 81-84-5.mol |
|
1,8-Naphthalic anhydride Chemical Properties
| Melting point | 269 °C |
| Boiling point | 295.48°C (rough estimate) |
| density | 1.2571 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5550 (estimate) |
| Fp | 272 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly, Heated), DMSO |
| form | Powder |
| color | Beige to light brown |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 153190 |
| InChI | 1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
| InChIKey | GRSMWKLPSNHDHA-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cccc3cccc1c23 |
| LogP | 3.24 |
| Surface tension | 72.5mN/m at 1.3mg/L and 20℃ |
| CAS DataBase Reference | 81-84-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,8-Naphthalic anhydride(81-84-5) |
| EPA Substance Registry System | 1,8-Naphthalic anhydride (81-84-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 2 |
| RTECS | QK5350000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Hazardous Substances Data | 81-84-5(Hazardous Substances Data) |
1,8-Naphthalic anhydride Usage And Synthesis
| Chemical Properties | BEIGE TO LIGHT BROWN POWDER |
| Uses | Dyestuffs, organic synthesis in general. |
| Uses | 1,8-Naphthalic anhydride is used as a seed protectant and to prepare dyestuffs and optical brighteners. It is used in the preparation of napthalimide analogues, which finds application as anticancer agents. Further, it is used as fluorescent brightening agent for polymeric materials. |
| Definition | ChEBI: Naphthalic anhydride is a cyclic dicarboxylic anhydride. |
| Purification Methods | Extract it with cold aqueous Na2CO3 to remove free acid, then crystallise from acetic anhydride. [Beilstein 17 III/IV 6392, 17/11 V 492.] |
1,8-Naphthalic anhydride Preparation Products And Raw materials
| Raw materials | Acenaphthene |
| Preparation Products | 1,8-NAPHTHALIC ACID-->fluorescent whitening agent EFR-->Solvent Yellow 98-->1-AMINO-8-NAPHTHOIC ACID-->SOLVENT YELLOW 85-->Pigment Red 190-->Fluorescent Yellow Ii (Disperse)-->Solvent Red 179-->3,4,9,10-Perylenetetracarboxylic dianhydride-->1,8-DIMETHYLNAPHTHALENE-->Vat Grey BG-->3,9-perylenedicarboxylic acid-->N-Hydroxynaphthalimide triflate-->3-Hydroxy-1,8-naphthalic anhydride-->8-Methyl-1-naphthalenemethanol-->4-Chloro-1,8-naphthalic anhydride-->2,3-Naphthalenedicarboxylic acid-->Solvent Red 179-->Fluorescent Yellow Ii (Disperse) |
