Introduction：Basic information about 1,8-DINITROANTHRAQUINONE CAS 129-39-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,8-DINITROANTHRAQUINONE Basic information
| Product Name: | 1,8-DINITROANTHRAQUINONE |
| Synonyms: | 1,8-dinitro-10-anthracenedione;1,8-Dinitro-9,10-anthracenedione;10-Anthracenedione,1,8-dinitro-9;1,8-DINITROANTHRAQUINONE;1,8-dinitroanthracene-9,10-dione;1,8-DINITRO ANTHRAQUINONE 97% MIN;1,8-Dinitro-9,10-anthraquinone;1,8-Dinitroanthraquinone 97% |
| CAS: | 129-39-5 |
| MF: | C14H6N2O6 |
| MW: | 298.21 |
| EINECS: | 204-943-0 |
| Product Categories: | Intermediates of Dyes and Pigments;C13 to C14;Carbonyl Compounds;Ketones |
| Mol File: | 129-39-5.mol |
|
1,8-DINITROANTHRAQUINONE Chemical Properties
| Melting point | 318-322 °C (lit.) |
| Boiling point | 563.4±50.0 °C(Predicted) |
| density | 1.631±0.06 g/cm3(Predicted) |
| storage temp. | -20°C, Inert atmosphere |
| solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)12-8(13)4-2-6-10(12)16(21)22/h1-6H |
| InChIKey | MBIJFIUDKPXMAV-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C(=O)C3=C(C2=O)C([N+]([O-])=O)=CC=C3)=CC=C1 |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,8-dinitro- (129-39-5) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2914790090 |
| Storage Class | 4.1A - Other explosive hazardous materials |
1,8-DINITROANTHRAQUINONE Usage And Synthesis
| Chemical Properties | Crystallized in acetic anhydride, it is yellow prisms. Slightly soluble in common organic solvents. |
| Uses | 1,8-Dinitroanthracene-9,10-dione is used in preparation method of disperse dyes using 1-aminoanthraquinone DMF residue. |
1,8-DINITROANTHRAQUINONE Preparation Products And Raw materials
| Preparation Products | 1,8-Bis(phenylthio)-9,10-anthracenedione-->C.I. Mordant Blue 8-->Acid Blue 80-->ACID VIOLET 34-->n-Hydroxy succinate-->C.I. Acid Blue 8-->DISPERSE BLUE 1 |
