Introduction:Basic information about 10-(2-Naphthyl)anthracene-9-boronic acid CAS 597554-03-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
10-(2-Naphthyl)anthracene-9-boronic acid Basic information
| Product Name: | 10-(2-Naphthyl)anthracene-9-boronic acid |
| Synonyms: | (9-(Naphthyl-2-yl)anthracene-10-yl)boronic acid;10-(2-Naphthyl)anthracene-9-boronic acid;10-(2-Naphthyl)anthr;9-(naphthalen-3-yl)anthracen-10-yl-10-boronic acid;10-(Naphthalene-2-yl)anthracene-9-yl boronic acid;9-(naphthalen-2-yl)anthracen-10-yl-10-boronic acid;10-(naphthalen-2-yl)anthracen-9-ylboronic acid;10-(Naphthalen-2-yl)anthracene-9-boronic acid |
| CAS: | 597554-03-5 |
| MF: | C24H17BO2 |
| MW: | 348.2 |
| EINECS: | 808-164-2 |
| Product Categories: | OLED materials,pharm chemical,electronic;OLED |
| Mol File: | 597554-03-5.mol |
|
10-(2-Naphthyl)anthracene-9-boronic acid Chemical Properties
| Boiling point | 585.8±58.0 °C(Predicted) |
| density | 1.30 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.63±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C24H17BO2/c26-25(27)24-21-11-5-3-9-19(21)23(20-10-4-6-12-22(20)24)18-14-13-16-7-1-2-8-17(16)15-18/h1-15,26-27H |
| InChIKey | YGVDBZMVEURVOW-UHFFFAOYSA-N |
| SMILES | B(C1C2=CC=CC=C2C(C2=CC=C3C(=C2)C=CC=C3)=C2C=1C=CC=C2)(O)O |
| CAS DataBase Reference | 597554-03-5 |
Safety Information
10-(2-Naphthyl)anthracene-9-boronic acid Usage And Synthesis
| Chemical Properties | White powder |
| Uses | 10-(2-Naphthyl)anthracene-9-boronic acid is often used to perform metal coupling reactions such as Suzuki. |
10-(2-Naphthyl)anthracene-9-boronic acid Preparation Products And Raw materials
| Raw materials | 9-Bromo-10-(2-naphthyl)anthracene-->9-(2-Naphthyl)anthracene-->2-Naphthaleneboronic acid-->TRIMETHYLBORON-->Triisopropyl borate-->Water |
10-(2-Benzothiazolyl)-2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H,11H-(1)benzopyropyrano(6,7-8-I,j)