Introduction：Basic information about 10,10'-Dibromo-9,9'-bianthryl CAS 121848-75-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
10,10'-Dibromo-9,9'-bianthryl Basic information
| Product Name: | 10,10'-Dibromo-9,9'-bianthryl |
| Synonyms: | 10,10'-Dibromo-9,9'-bianthryl;9,9'-Bianthracene,10,10'-dibromo-;9,9'-Bianthryl, 10,10'-dibromo- (6CI);10,10'-dibromo-9,9'-Bianthracene;10,10'-Dibromo-9,9'-;9-bromo-10-(10-bromoanthracen-9-yl)anthracene;10,10'-Dibromo-9,9'-Bianthryl 98%;IN1082, 10,10'-Dibromo-9,9'-bianthryl |
| CAS: | 121848-75-7 |
| MF: | C28H16Br2 |
| MW: | 512.23 |
| EINECS: | |
| Product Categories: | Electronic Chemicals;OLED |
| Mol File: | 121848-75-7.mol |
|
10,10'-Dibromo-9,9'-bianthryl Chemical Properties
| Melting point | 357-359 ºC |
| Boiling point | 599.0±45.0 °C(Predicted) |
| density | 1.583 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| color | White to Yellow to Green |
| λmax | 404nm(CHCl3)(lit.) |
| InChI | 1S/C28H16Br2/c29-27-21-13-5-1-9-17(21)25(18-10-2-6-14-22(18)27)26-19-11-3-7-15-23(19)28(30)24-16-8-4-12-20(24)26/h1-16H |
| InChIKey | NPNNLGXEAGTSRN-UHFFFAOYSA-N |
| SMILES | BrC1=C2C(C=CC=C2)=C(C3=C(C=CC=C4)C4=C(Br)C5=C3C=CC=C5)C6=CC=CC=C61 |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
10,10'-Dibromo-9,9'-bianthryl Usage And Synthesis
| Chemical Properties | off-white powder |
10,10'-Dibromo-9,9'-bianthryl Preparation Products And Raw materials
