Introduction:Basic information about 13-O-p-Coumaroylplumieride CAS 80416-52-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
13-O-p-Coumaroylplumieride Basic information
| Product Name: | 13-O-p-Coumaroylplumieride |
| Synonyms: | 13-O-p-Coumaroylplumieride;Plumeride p-coumarate;Spiro[cyclopenta[c]pyran-7(1H),2'(5'H)-furan]-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-4a,7a-dihydro-4'-[1-[[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]ethyl]-5'-oxo-, methyl ester, [1S-[1α,4aα,7α(R*),7aα]]- (9CI);13-O-p-coumaroylplumeride |
| CAS: | 80416-52-0 |
| MF: | C30H32O14 |
| MW: | 616.57 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 80416-52-0.mol |
|
13-O-p-Coumaroylplumieride Chemical Properties
| Boiling point | 870.9±65.0 °C(Predicted) |
| density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 8.57±0.15(Predicted) |
| form | solid |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | WBCMGDNFDRNGGZ-DEYYTONKSA-N |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]3[C@@H]1C=C[C@]34OC(=O)C(=C4)[C@H](C)OC(=O)\C=C\c5ccc(O)cc5 |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
13-O-p-Coumaroylplumieride Usage And Synthesis
| Uses | metabolomics vitamins, nutraceuticals, and natural products |
13-O-p-Coumaroylplumieride Preparation Products And Raw materials