Introduction：Basic information about 1-Benzhydrylazetane-3-carbonitrile CAS 36476-86-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Benzhydrylazetane-3-carbonitrile Basic information
| Product Name: | 1-Benzhydrylazetane-3-carbonitrile |
| Synonyms: | 1-BENZHYDRYLAZETANE-3-CARBONITRILE;1-BENZHYDRYL-AZETIDINE-3-CARBONITRILE;1-BENZHYDRYL-3-CYANOAZETIDINE;BUTTPARK 37\04-15;3-CYANO-1-(DIPHENYLMETHYL)AZETIDINE;1-BENZHYDRYL-3-CYANOAZETIDINE 98%;1-(diphenylmethyl)azetidine-3-carbonitrile;3-azetidinecarbonitrile, 1-(diphenylmethyl)- |
| CAS: | 36476-86-5 |
| MF: | C17H16N2 |
| MW: | 248.32 |
| EINECS: | |
| Product Categories: | Aromatics;Heterocycles;Azetidine;1 |
| Mol File: | 36476-86-5.mol |
|
1-Benzhydrylazetane-3-carbonitrile Chemical Properties
| Melting point | 150-153°C |
| Boiling point | 384.3±42.0 °C(Predicted) |
| density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.61±0.10(Predicted) |
| color | White |
| Stability: | Good |
| InChI | InChI=1S/C17H16N2/c18-11-14-12-19(13-14)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,14,17H,12-13H2 |
| InChIKey | IXMOEAHDRKNAAG-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(C#N)C1 |
| CAS DataBase Reference | 36476-86-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3276 |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29339900 |
1-Benzhydrylazetane-3-carbonitrile Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | A proline analog and proline formation inhibitor |
| Synthesis | 1-Diphenylmethyl-3-cyanoazetidine can be prepared from diphenylmethylamine as raw material firstly 1-Diphenylmethyl-3-hydroxyazetidine, then methylsulfonylated to obtain 1-Diphenylmethyl-3-(methylsulfonyloxy)azetidine, and finally reacted with sodium cyanide to obtain 1-Diphenylmethyl-3-cyanoazetidine. |
1-Benzhydrylazetane-3-carbonitrile Preparation Products And Raw materials
| Preparation Products | 1-(DIPHENYLMETHYL)-3-(HYDROXYMETHYL)AZETIDINE-->AZETIDINE-3-CARBONITRILE HYDROCHLORIDE-->1-Benzhydrylazetidine-3-carboxylic acid-->1-[1-(Diphenylmethyl)-3-azetidinyl]-cyclopropanamine |
