Introduction:Basic information about 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene CAS 168971-68-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Basic information
| Product Name: | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene |
| Synonyms: | 1-Bromo-2-fluoro-4-(trifluoromethocy)benzene;1-BROMO-2-FLUORO-4-(TRIFLUOROMETHOXY)BENZENE;1- Bromo-2-Fluoro-4-(Trifluoromethoxyl)-Benzene;1-BROMO-2-FLUORO-4-(TRIFLUOROMETHOXY)BENZENE 98%;3-Fluoro-4-bromotrifluoromethoxybenzene;4-Bromo-3-fluoro(trifluoromethoxy)benzene;1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene, 98%pale yellow liquid;Benzene, 1-bromo-2-fluoro-4-(trifluoromethoxy)- |
| CAS: | 168971-68-4 |
| MF: | C7H3BrF4O |
| MW: | 259 |
| EINECS: | 675-086-1 |
| Product Categories: | Trifluoroanisole series;Trifluoro-methoxy-benzene series |
| Mol File: | 168971-68-4.mol |
|
1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Chemical Properties
| Boiling point | 158.5±35.0 °C(Predicted) |
| density | 1.724±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Pale yellow |
| InChI | InChI=1S/C7H3BrF4O/c8-5-2-1-4(3-6(5)9)13-7(10,11)12/h1-3H |
| InChIKey | KZMHSGBETSENAT-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OC(F)(F)F)C=C1F |
| CAS DataBase Reference | 168971-68-4(CAS DataBase Reference) |
Safety Information
1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Usage And Synthesis
| Uses | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene can be used as a synthetic intermediate in the field of chemical synthesis to prepare complex organic molecules containing trifluoromethoxy (OCF3), and is of great significance in medicinal chemistry and pesticide chemistry. |
1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Preparation Products And Raw materials