Introduction：Basic information about 1-Bromo-2-naphthol CAS 573-97-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Bromo-2-naphthol Basic information
| Product Name: | 1-Bromo-2-naphthol |
| Synonyms: | 1-brom-2-naphthol;1-BROMO-2-HYDROXYNAPHTHALENE;Bromonaphthol;2-Naphthalenol, 1-bromo-;1-Bromo-b-naphthol;1-Bromonaphthalen-2-ol ,98%;1-Bromonaphthalene-2-ol;1-Bromo-2-naphtalenol |
| CAS: | 573-97-7 |
| MF: | C10H7BrO |
| MW: | 223.07 |
| EINECS: | 209-363-1 |
| Product Categories: | Building Blocks;C9 to C20+;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;API intermediates;Organic Building Blocks;Oxygen Compounds;Phenols;bc0001 |
| Mol File: | 573-97-7.mol |
|
1-Bromo-2-naphthol Chemical Properties
| Melting point | 78-81 °C (lit.) |
| Boiling point | 130°C |
| density | 1.4412 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 7.28±0.50(Predicted) |
| color | Off-white to beige or brown-purple |
| BRN | 2044001 |
| InChI | InChI=1S/C10H7BrO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1O |
| CAS DataBase Reference | 573-97-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | QL3361000 |
| HazardClass | IRRITANT |
| HS Code | 29081000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
1-Bromo-2-naphthol Usage And Synthesis
| Chemical Properties | off-white to beige or brown-purple cryst. powder |
| Synthesis Reference(s) | Tetrahedron, 51, p. 4291, 1995 DOI: 10.1016/0040-4020(94)01119-K |
| Purification Methods | Distil the naphthol at pKEst 10mm then recrystallise it from *C6H6/pet ether (b 30-60o) m 80-81o. The benzoyl derivative has m 98.5-99.5o (from MeOH). [Hazlet J Am Cherm Soc 62 2156 1940, Beilstein 6 H 650, 6 II 604, 6 III 2994.] |
1-Bromo-2-naphthol Preparation Products And Raw materials
| Raw materials | Sulfur dioxide-->1,3-Dibromonaphthalene-2-ol-->(2-Naphtyloxy)trimethylsilane-->2-(Benzyloxy)-1-broMonaphthalene-->2-HYDROXY-1-NAPHTHOIC ACID-->1-BROMO-2-METHOXYNAPHTHALENE-->2-Hydroxy-1-naphthaldehyde |
| Preparation Products | DINAPHTHO[1,2-B:1',2'-D]FURAN-->(2-METHOXY-1-NAPHTHYL)BORONIC ACID |
