Introduction：Basic information about 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- CAS 131538-00-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Basic information
| Product Name: | 1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- |
| Synonyms: | 1,2-Bis[(2-mercaptoethyl)thio]-3-mercaptopropane;4-(Mercaptomethyl)-1,8-dimercapto-3,6-dithiaoctane;1-Propanethiol,2,3-bis[(2-Mercaptoethyl)thio]-;2,3-bis(2-sulfanylethylsulfanyl)propane-1-thiol;Monomer-PETP;YF-FM PETP;4-Mercaptomethyl-3,6-dithia-1,8-octanedithiol;2,3-bis((2-mercaptoethyl)thio)-1-propanethiol |
| CAS: | 131538-00-6 |
| MF: | C7H16S5 |
| MW: | 260.53 |
| EINECS: | 411-290-7 |
| Product Categories: | |
| Mol File: | 131538-00-6.mol |
|
1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Chemical Properties
| Boiling point | 395.6±42.0 °C(Predicted) |
| density | 1.214 |
| vapor pressure | 56.2Pa at 20℃ |
| solubility | 13190 in mg/100g standard fat at 20 ℃ |
| pka | 9.57±0.10(Predicted) |
| Water Solubility | 12mg/L at 20℃ |
| InChI | InChI=1S/C7H16S5/c8-1-3-11-6-7(5-10)12-4-2-9/h7-10H,1-6H2 |
| InChIKey | CEUQYYYUSUCFKP-UHFFFAOYSA-N |
| SMILES | C(S)C(SCCS)CSCCS |
| LogP | 3.16 at 25℃ |
| EPA Substance Registry System | 1-Propanethiol, 2,3-bis[(2-mercaptoethyl)thio]- (131538-00-6) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-48/22-50/53 |
| Safety Statements | 23-24/25-36-60-61 |
| TSCA | TSCA listed |
1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Usage And Synthesis
| Uses | 2,3-bis(2-mercaptoethyl)thio)-1-propanethiol is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |
| Flammability and Explosibility | Non flammable |
1-Propanethiol,2,3-bis[(2-mercaptoethyl)thio]- Preparation Products And Raw materials
| Raw materials | 2-Mercaptoethanol-->Epichlorohydrin |
