Introduction:Basic information about CAS 25034-71-3|4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro-, polymer with ethene and 1-propen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro-, polymer with ethene and 1-propene |
|---|
| CAS Number | 25034-71-3 | Molecular Weight | 202.33500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H22 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro-, polymer with ethene and 1-propene |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H22 |
|---|
| Molecular Weight | 202.33500 |
|---|
| Exact Mass | 202.17200 |
|---|
| LogP | 4.37910 |
|---|
| InChIKey | FONZLIJOWFDKNC-UHFFFAOYSA-N |
|---|
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=C.C=CC |
|---|