Introduction：Basic information about 2-(2-chloro-5-nitrophenyl)pyridine CAS 879088-40-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(2-chloro-5-nitrophenyl)pyridine Basic information
| Product Name: | 2-(2-chloro-5-nitrophenyl)pyridine |
| Synonyms: | 2-(2-chloro-5-nitrophenyl)pyridine;4-Chloro-3-(pyridin-2-yl)nitrobenzene;2-(2-chloro-5-nitrophenyl)pyridine hydrochloride;Pyridine, 2-(2-chloro-5-nitrophenyl)-;Vismodegib Impurity 10 |
| CAS: | 879088-40-1 |
| MF: | C11H7ClN2O2 |
| MW: | 234.64 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 879088-40-1.mol |
|
2-(2-chloro-5-nitrophenyl)pyridine Chemical Properties
| Boiling point | 360.2±32.0 °C(Predicted) |
| density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.10±0.24(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C11H7ClN2O2/c12-10-5-4-8(14(15)16)7-9(10)11-3-1-2-6-13-11/h1-7H |
| InChIKey | AKVCBZWZBMTKMQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC([N+]([O-])=O)=CC=C2Cl)=NC=CC=C1 |
Safety Information
2-(2-chloro-5-nitrophenyl)pyridine Usage And Synthesis
| Uses | 2-(2-Chloro-5-nitrophenyl)pyridine is used in the synthesis of Vismondegib (V674700) a hedgehog pathway inhibitor |
2-(2-chloro-5-nitrophenyl)pyridine Preparation Products And Raw materials
| Preparation Products | 4-chloro-3-(pyridin-2-yl)aniline |
