Introduction：Basic information about 2-（3-Bromophenyl）triphenylene CAS 1313514-53-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-（3-Bromophenyl）triphenylene Basic information
| Product Name: | 2-（3-Bromophenyl）triphenylene |
| Synonyms: | 2-(3-broMophenyl)triphenylene;Triphenylene, 2-(3-bromophenyl)-;2-(tribromophenyl)triphenylene;2-(3-Bromophenyl)triphenylene >2-(tribromophenyl) sanybenzene;Bromophenyltriphenylene;2-(3-Bromophenyl)phenanthrene |
| CAS: | 1313514-53-2 |
| MF: | C24H15Br |
| MW: | 383.28 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1313514-53-2.mol |
|
2-（3-Bromophenyl）triphenylene Chemical Properties
| Melting point | 147.0 to 151.0 °C |
| Boiling point | 556.4±19.0 °C(Predicted) |
| density | 1.402±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C24H15Br/c25-18-7-5-6-16(14-18)17-12-13-23-21-10-2-1-8-19(21)20-9-3-4-11-22(20)24(23)15-17/h1-15H |
| InChIKey | KWXFBIBEVROWEF-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C4C2=CC=CC=4)=CC=CC=3)=CC=C1C1=CC=CC(Br)=C1 |
Safety Information
2-（3-Bromophenyl）triphenylene Usage And Synthesis
| Chemical Properties | Class white powder |
| Uses | 2-（3-Bromophenyl）triphenylene is a moiety with an activated electron that has quantum efficiency as high as thermally. It can be used to make devices such as light emitting diodes (LEDs) and photodetectors. 2-（3-Bromophenyl）triphenylene has been shown to have low efficiency in fluorescent devices, but it can be stacked with other compounds to increase the efficiency of phosphorescent devices. |
2-（3-Bromophenyl）triphenylene Preparation Products And Raw materials
| Raw materials | 4,4,5,5-TetraMethyl-2-(3-triphenylen-2-yl-phenyl)-[1,3,2]dioxaborolane-->B-2-Triphenylenylboronic acid-->1-Bromo-3-iodobenzene-->1,3-Dibromobenzene |
