Introduction：Basic information about 2-(chloromethyl)-4-methylquinazoline CAS 109113-72-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(chloromethyl)-4-methylquinazoline Basic information
| Product Name: | 2-(chloromethyl)-4-methylquinazoline |
| Synonyms: | 2-(chloromethyl)-4-methylquinazoline;Quinazoline,2-(chloroMethyl)-4-Methyl-;Linagliptin interMediate A;2-chloroMethyl-4-Methyl quinaoline;Linagliptin INT3;Linaint-I;2-(chloromethyl)-4-methylquizoline;Linagliptin 2-Chloromethyl Impurity |
| CAS: | 109113-72-6 |
| MF: | C10H9ClN2 |
| MW: | 192.64 |
| EINECS: | 476-280-7 |
| Product Categories: | Intermediates;109113-72-6 |
| Mol File: | 109113-72-6.mol |
|
2-(chloromethyl)-4-methylquinazoline Chemical Properties
| Melting point | 61.0 to 65.0 °C |
| Boiling point | 240.0±32.0 °C(Predicted) |
| density | 1.251 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 1.86±0.50(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | 3.11g/L at 20℃ |
| λmax | 318nm(EtOH)(lit.) |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C10H9ClN2/c1-7-8-4-2-3-5-9(8)13-10(6-11)12-7/h2-5H,6H2,1H3 |
| InChIKey | UHCUBOJGMLASBY-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC=C2)=C(C)N=C1CCl |
| LogP | 1.9 at 25℃ |
Safety Information
| RIDADR | 3261 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2933998090 |
2-(chloromethyl)-4-methylquinazoline Usage And Synthesis
| Chemical Properties | White to yellow powder |
| Uses | 2-(Chloromethyl)-4-methylquinazoline, is a building block used for the preparation of Linagliptin (L465900), and its impurities, acting as type 2 diabetes drugs. |
| Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 23, p. 1263, 1986 DOI: 10.1002/jhet.5570230458 |
| Flammability and Explosibility | Not classified |
| Synthesis | Into a 500ml reaction flask, add o-aminoacetophenone, chloroacetonitrile, 1,4-dioxane, and N-methyl-3(3-sulfopropyl)imidazolium hydrogen sulfate prepared above. Stir to dissolve, cool the reaction system to 8°C, and dropwise add hydrochloric acid to the reaction system. The reaction temperature was kept unchanged during the dropwise addition. After that, the reaction was continued at 8°C for 18 hours to complete the reaction process. After the reaction, ammonia water (the concentration of ammonia water was 10wt%) at 5°C was added to the reaction system. After stirring and crystallizing at 5 for 30 minutes, filter to obtain a filter cake, washing the filter cake with water. Recrystallized with 200ml of dichloromethane to obtain 2-(chloromethyl)-4-methylquinazoline. yield: 85.14%
|
2-(chloromethyl)-4-methylquinazoline Preparation Products And Raw materials
| Raw materials | Ro 5-3663-->2-Aminoacetophenone |
