Introduction：Basic information about 2-(Chloromethyl)benzonitrile CAS 612-13-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(Chloromethyl)benzonitrile Basic information
| Product Name: | 2-(Chloromethyl)benzonitrile |
| Synonyms: | alpha-chloro-o-tolunitril;o-(chloromethyl)benzonitrile;AKOS BBS-00003977;2-(Chloromethyl)tolunitrile;2-(CHLOROMETHYL)BENZONITRILE;2-CYANZYLCHLORIDE;o-Cyano-α-chlorotoluene;2-(chloromethyl)benzenecarbonitrile |
| CAS: | 612-13-5 |
| MF: | C8H6ClN |
| MW: | 151.59 |
| EINECS: | 210-292-3 |
| Product Categories: | Intermediates of Dyes and Pigments |
| Mol File: | 612-13-5.mol |
|
2-(Chloromethyl)benzonitrile Chemical Properties
| Melting point | 56-61°C |
| Boiling point | 252°C(lit.) |
| density | 1.1976 (rough estimate) |
| refractive index | 1.5437 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H6ClN/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5H2 |
| InChIKey | ZSHNOXOGXHXLAV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1CCl |
| CAS DataBase Reference | 612-13-5(CAS DataBase Reference) |
Safety Information
| RIDADR | UN 2923 8/6.1/PG II |
| HazardClass | 8/6.1 |
| PackingGroup | II |
| HS Code | 2926907090 |
2-(Chloromethyl)benzonitrile Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
2-(Chloromethyl)benzonitrile Preparation Products And Raw materials
| Raw materials | o-Toluic acid-->Chlorine-->o-Tolunitrile |
| Preparation Products | Fluorescent brightener PS-1-->2-[(6-Chloro-3,4-dihydro-3-Methyl-2,4-dioxo-1(2h)-pyriMidinyl)Methyl]benzonitrile-->2-(PHENOXYMETHYL)BENZONITRILE 97-->2-Cyanobenzyl acetate-->2-[(4-formyl-2-methoxyphenoxy)methyl]benzonitrile |
