Introduction：Basic information about 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole CAS 7189-82-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Basic information
- 2. 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Chemical Properties
- 3. Safety Information
- 4. 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Usage And Synthesis
- 5. 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Preparation Products And Raw materials
2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Basic information
| Product Name: | 2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole |
| Synonyms: | 2,2'-di-(o-nitrophenoxy)-biphenyl;2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole (BCIM);2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazo;2,2’-bis(o-chlorophenyl)-4,4’,5,5’-tetraphenyl-1,2’-bi(iii-imidazole);2-(2-CHLOROPHENYL)-1-[2-(2-CHLOROPHENYL)-4,5-DIPHENYL-IMIDAZOL-2-YL]-4,5-DIPHENYL-IMIDAZOLE;Photopolymerizationinitiator;2,2'-Bis(2-chlorophenyl)-4,5,4',5'-tetraphenyl-1,2'-biimidazole;BCIM |
| CAS: | 7189-82-4 |
| MF: | C42H28Cl2N4 |
| MW: | 659.6 |
| EINECS: | 230-555-6 |
| Product Categories: | Other Products;Industrial/Fine Chemicals;Functional Materials;Photopolymerization Initiators |
| Mol File: | 7189-82-4.mol |
|
2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Chemical Properties
| Melting point | 194°C |
| Boiling point | 810.3±75.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid:crystalline |
| pka | 3.37±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C42H28Cl2N4/c43-35-27-15-13-25-33(35)41-45-39(31-21-9-3-10-22-31)40(32-23-11-4-12-24-32)48(41)42(34-26-14-16-28-36(34)44)46-37(29-17-5-1-6-18-29)38(47-42)30-19-7-2-8-20-30/h1-28H |
| InChIKey | MHDULSOPQSUKBQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2Cl)N(C2(C3=CC=CC=C3Cl)N=C(C3=CC=CC=C3)C(C3=CC=CC=C3)=N2)C(C2=CC=CC=C2)=C(C2=CC=CC=C2)N=1 |
| LogP | 7.6 at 35℃ and pH9 |
| CAS DataBase Reference | 7189-82-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole, 2-(2-chlorophenyl)-1-[2-(2-chlorophenyl)-4,5-diphenyl-2H-imidazol-2-yl]-4,5-diphenyl- (7189-82-4) |
Safety Information
| TSCA | TSCA listed |
| HS Code | 29339900 |
2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Usage And Synthesis
| Uses | 2,2''-Bis(2-chlorophenyl)-4,4'',5,5''-tetraphenyl-1,2''-biimidazole (CAS# 7189-82-4) is a hexaarylbiimidazole (HABI), a visible light thiol-ene photoinitiator, such as in the polymerization of 1,6-hexanediol diacrylate by hexaarylbisimidazoles and heterocyclic mercapto compounds. |
| Synthesis | Preparation of a bisimidazole photoinitiator (BCIM):
1. BCIM monomer wet cake is oxidatively coupled using H?O? in a biphasic system (aqueous alkali/dichloromethane) with a quaternary ammonium salt as phase-transfer catalyst.
2. Work-up: separation of organic phase, washing, and distillation to recover dichloromethane.
3. Isopropanol is added and distilled until turbidity. Water is added to crystallize the product, which is filtered, washed with isopropanol, and dried. |
2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,2'-biimidazole Preparation Products And Raw materials
| Preparation Products | Bifonazole-->2,4,5-Triphenylimidazole |
