Introduction：Basic information about 2,3-Dichlorobenzotrifluoride CAS 54773-19-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3-Dichlorobenzotrifluoride Basic information
| Product Name: | 2,3-Dichlorobenzotrifluoride |
| Synonyms: | 2,3-DICHLOROBENZOTRIFLUORIDE;1,2-dichloro-3-(trifluoromethyl)benzene;2,3-Dichlorobenzotrifluoride 98%;2,3-Dichlorobenzotrifluoride98%;1-(Trifluoromethyl)-2,3-dichlorobenzene;2,3-Dichloro-1-(trifluoromethyl)benzene;2,3-Dichloro-trifluororide;2,3-Dichloro-α,α,α-trifluorotoluene |
| CAS: | 54773-19-2 |
| MF: | C7H3Cl2F3 |
| MW: | 215 |
| EINECS: | 259-336-3 |
| Product Categories: | |
| Mol File: | 54773-19-2.mol |
|
2,3-Dichlorobenzotrifluoride Chemical Properties
| Melting point | -26 C |
| Boiling point | 177-179 C |
| density | 1,483 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C7H3Cl2F3/c8-5-3-1-2-4(6(5)9)7(10,11)12/h1-3H |
| InChIKey | BJYHBJUWZMHGGQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(C(F)(F)F)=C1Cl |
| CAS DataBase Reference | 54773-19-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,2-dichloro-3-(trifluoromethyl)- (54773-19-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| RIDADR | UN1760 |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
2,3-Dichlorobenzotrifluoride Usage And Synthesis
| Uses | 2,3-Dichlorobenzotrifluoride can be used as an intermediate in the synthesis of darifenacin. |
2,3-Dichlorobenzotrifluoride Preparation Products And Raw materials
| Preparation Products | 3,4-Dichlorobenzotrifluoride |
